CAS 926-09-0 appears in our catalog under these names: 1,1’-Thiobismethane-d3 (Dimethyl Sulfide-d6), >95% (GC), 1,1'-Thiobismethane-d3 (Dimethyl Sulfide-d6), >95% (GC), (METHYL SULFIDE)-D6, 99.0 ATOM % D. Offered by: TRC, Sigma-Aldrich. Available pack sizes: 250mg, 5g, 1G.
Trideuterio(trideuteriomethylsulfanyl)methane (CAS 926-09-0) is a chemical compound with the molecular formula C2H6S and a molecular weight of 68.17 g/mol. IUPAC name: trideuterio(trideuteriomethylsulfanyl)methane. InChIKey: QMMFVYPAHWMCMS-WFGJKAKNSA-N.
| Molecular formula | C2H6S |
|---|---|
| Molecular weight | 68.17 g/mol |
| IUPAC name | trideuterio(trideuteriomethylsulfanyl)methane |
| InChIKey | QMMFVYPAHWMCMS-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])SC([2H])([2H])[2H] |
Computed by PubChem (NCBI)