CAS 92612-60-7 is the registry number for Isothiocyanatoethane-d5. Offered by: TRC. Available pack sizes: 50mg.
1,1,1,2,2-pentadeuterio-2-isothiocyanatoethane (CAS 92612-60-7) is a chemical compound with the molecular formula C3H5NS and a molecular weight of 92.18 g/mol. IUPAC name: 1,1,1,2,2-pentadeuterio-2-isothiocyanatoethane. InChIKey: HBNYJWAFDZLWRS-ZBJDZAJPSA-N.
| Molecular formula | C3H5NS |
|---|---|
| Molecular weight | 92.18 g/mol |
| IUPAC name | 1,1,1,2,2-pentadeuterio-2-isothiocyanatoethane |
| InChIKey | HBNYJWAFDZLWRS-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])N=C=S |
Computed by PubChem (NCBI)