CAS 926193-00-2 appears in our catalog under these names: 6-Bromo-2-(2-(thiophen-2-yl)ethenyl)quinoline-4-carboxylic acid, 6-Bromo-2-(2-(thiophen-2-yl)ethenyl)quinoline-4-carboxylic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 100mg, 1g, 5g.
6-bromo-2-[(E)-2-thiophen-2-ylethenyl]quinoline-4-carboxylic acid (CAS 926193-00-2) is a chemical compound with the molecular formula C16H10BrNO2S and a molecular weight of 360.2 g/mol. IUPAC name: 6-bromo-2-[(E)-2-thiophen-2-ylethenyl]quinoline-4-carboxylic acid. InChIKey: SJOZRJUFOKUWMW-SNAWJCMRSA-N.
| Molecular formula | C16H10BrNO2S |
|---|---|
| Molecular weight | 360.2 g/mol |
| IUPAC name | 6-bromo-2-[(E)-2-thiophen-2-ylethenyl]quinoline-4-carboxylic acid |
| InChIKey | SJOZRJUFOKUWMW-SNAWJCMRSA-N |
| SMILES | C1=CSC(=C1)/C=C/C2=CC(=C3C=C(C=CC3=N2)Br)C(=O)O |
Computed by PubChem (NCBI)