CAS 926204-88-8 appears in our catalog under these names: 6-Bromo-2-(2-(pyridin-4-yl)ethenyl)quinoline-4-carboxylic acid, 95%, 6-Bromo-2-(2-(pyridin-4-yl)ethenyl)quinoline-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
6-bromo-2-[(E)-2-pyridin-4-ylethenyl]quinoline-4-carboxylic acid (CAS 926204-88-8) is a chemical compound with the molecular formula C17H11BrN2O2 and a molecular weight of 355.2 g/mol. IUPAC name: 6-bromo-2-[(E)-2-pyridin-4-ylethenyl]quinoline-4-carboxylic acid. InChIKey: KKNHYSSJHQAITJ-HNQUOIGGSA-N.
| Molecular formula | C17H11BrN2O2 |
|---|---|
| Molecular weight | 355.2 g/mol |
| IUPAC name | 6-bromo-2-[(E)-2-pyridin-4-ylethenyl]quinoline-4-carboxylic acid |
| InChIKey | KKNHYSSJHQAITJ-HNQUOIGGSA-N |
| SMILES | C1=CC2=NC(=CC(=C2C=C1Br)C(=O)O)/C=C/C3=CC=NC=C3 |
Computed by PubChem (NCBI)