CAS 926205-65-4 is the registry number for 3-(3,5-Dimethyl-1-(4-sulfamoylphenyl)-1H-pyrazol-4-yl)propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-[3,5-dimethyl-1-(4-sulfamoylphenyl)pyrazol-4-yl]propanoic acid (CAS 926205-65-4) is a chemical compound with the molecular formula C14H17N3O4S and a molecular weight of 323.37 g/mol. IUPAC name: 3-[3,5-dimethyl-1-(4-sulfamoylphenyl)pyrazol-4-yl]propanoic acid. InChIKey: ATSRJEPDHYZLQW-UHFFFAOYSA-N.
| Molecular formula | C14H17N3O4S |
|---|---|
| Molecular weight | 323.37 g/mol |
| IUPAC name | 3-[3,5-dimethyl-1-(4-sulfamoylphenyl)pyrazol-4-yl]propanoic acid |
| InChIKey | ATSRJEPDHYZLQW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2=CC=C(C=C2)S(=O)(=O)N)C)CCC(=O)O |
Computed by PubChem (NCBI)