Products 926208-10-8

CAS 926208-10-8 is the registry number for 1-(Prop-2-yn-1-yl)piperidine-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

1-prop-2-ynylpiperidine-4-carboxylic acid (CAS 926208-10-8) is a chemical compound with the molecular formula C9H13NO2 and a molecular weight of 167.20 g/mol. IUPAC name: 1-prop-2-ynylpiperidine-4-carboxylic acid. InChIKey: NUXDWZXJMMBHKO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13NO2
Molecular weight167.20 g/mol
IUPAC name1-prop-2-ynylpiperidine-4-carboxylic acid
InChIKeyNUXDWZXJMMBHKO-UHFFFAOYSA-N
SMILESC#CCN1CCC(CC1)C(=O)O

Computed by PubChem (NCBI)