CAS 926218-18-0 is the registry number for 1-Cyano-N-((4-fluorophenyl)methyl)-N-methylmethanesulfonamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-cyano-N-[(4-fluorophenyl)methyl]-N-methylmethanesulfonamide (CAS 926218-18-0) is a chemical compound with the molecular formula C10H11FN2O2S and a molecular weight of 242.27 g/mol. IUPAC name: 1-cyano-N-[(4-fluorophenyl)methyl]-N-methylmethanesulfonamide. InChIKey: PWCYLUWAGDAXFA-UHFFFAOYSA-N.
| Molecular formula | C10H11FN2O2S |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 1-cyano-N-[(4-fluorophenyl)methyl]-N-methylmethanesulfonamide |
| InChIKey | PWCYLUWAGDAXFA-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC=C(C=C1)F)S(=O)(=O)CC#N |
Computed by PubChem (NCBI)