CAS 926225-35-6 appears in our catalog under these names: 2-Amino-n-(2-chloro-4-fluorophenyl)benzamide, 95%, 2-Amino-N-(2-chloro-4-fluorophenyl)benzamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-amino-N-(2-chloro-4-fluorophenyl)benzamide (CAS 926225-35-6) is a chemical compound with the molecular formula C13H10ClFN2O and a molecular weight of 264.68 g/mol. IUPAC name: 2-amino-N-(2-chloro-4-fluorophenyl)benzamide. InChIKey: HTLFFIVHQKHSRW-UHFFFAOYSA-N.
| Molecular formula | C13H10ClFN2O |
|---|---|
| Molecular weight | 264.68 g/mol |
| IUPAC name | 2-amino-N-(2-chloro-4-fluorophenyl)benzamide |
| InChIKey | HTLFFIVHQKHSRW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=C(C=C(C=C2)F)Cl)N |
Computed by PubChem (NCBI)