CAS 926227-83-0 is the registry number for 3,5-Difluorobenzoyl isothiocyanate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3,5-difluorobenzoyl isothiocyanate (CAS 926227-83-0) is a chemical compound with the molecular formula C8H3F2NOS and a molecular weight of 199.18 g/mol. IUPAC name: 3,5-difluorobenzoyl isothiocyanate. InChIKey: NDVOIVNOHLKKGA-UHFFFAOYSA-N.
| Molecular formula | C8H3F2NOS |
|---|---|
| Molecular weight | 199.18 g/mol |
| IUPAC name | 3,5-difluorobenzoyl isothiocyanate |
| InChIKey | NDVOIVNOHLKKGA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)C(=O)N=C=S |
Computed by PubChem (NCBI)