CAS 105534-76-7 appears in our catalog under these names: 2,4-difluorobenzoyl isothiocyanate, 95%, 2,4-Difluorobenzoyl isothiocyanate 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2,4-difluorobenzoyl isothiocyanate (CAS 105534-76-7) is a chemical compound with the molecular formula C8H3F2NOS and a molecular weight of 199.18 g/mol. IUPAC name: 2,4-difluorobenzoyl isothiocyanate. InChIKey: JTFDJASHPGESKU-UHFFFAOYSA-N.
| Molecular formula | C8H3F2NOS |
|---|---|
| Molecular weight | 199.18 g/mol |
| IUPAC name | 2,4-difluorobenzoyl isothiocyanate |
| InChIKey | JTFDJASHPGESKU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C(=O)N=C=S |
Computed by PubChem (NCBI)