CAS 926234-83-5 appears in our catalog under these names: 6-Bromo-2-(2-(3-bromophenyl)ethenyl)quinoline-4-carboxylic acid, 95%, 6-Bromo-2-(2-(3-bromophenyl)ethenyl)quinoline-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
6-bromo-2-[(E)-2-(3-bromophenyl)ethenyl]quinoline-4-carboxylic acid (CAS 926234-83-5) is a chemical compound with the molecular formula C18H11Br2NO2 and a molecular weight of 433.1 g/mol. IUPAC name: 6-bromo-2-[(E)-2-(3-bromophenyl)ethenyl]quinoline-4-carboxylic acid. InChIKey: LDARHISNYXBFEC-GQCTYLIASA-N.
| Molecular formula | C18H11Br2NO2 |
|---|---|
| Molecular weight | 433.1 g/mol |
| IUPAC name | 6-bromo-2-[(E)-2-(3-bromophenyl)ethenyl]quinoline-4-carboxylic acid |
| InChIKey | LDARHISNYXBFEC-GQCTYLIASA-N |
| SMILES | C1=CC(=CC(=C1)Br)/C=C/C2=CC(=C3C=C(C=CC3=N2)Br)C(=O)O |
Computed by PubChem (NCBI)