Products 926235-03-2

CAS 926235-03-2 is the registry number for 4-(3,4-Dichlorophenyl)-2-fluorobenzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.

Structural formula: {0} (CAS {1})

4-(3,4-dichlorophenyl)-2-fluorobenzoic acid (CAS 926235-03-2) is a chemical compound with the molecular formula C13H7Cl2FO2 and a molecular weight of 285.09 g/mol. IUPAC name: 4-(3,4-dichlorophenyl)-2-fluorobenzoic acid. InChIKey: IUFAIVVWQHHJJL-UHFFFAOYSA-N.

Identity
Molecular formulaC13H7Cl2FO2
Molecular weight285.09 g/mol
IUPAC name4-(3,4-dichlorophenyl)-2-fluorobenzoic acid
InChIKeyIUFAIVVWQHHJJL-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C2=CC(=C(C=C2)Cl)Cl)F)C(=O)O

Computed by PubChem (NCBI)