CAS 926235-03-2 is the registry number for 4-(3,4-Dichlorophenyl)-2-fluorobenzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
4-(3,4-dichlorophenyl)-2-fluorobenzoic acid (CAS 926235-03-2) is a chemical compound with the molecular formula C13H7Cl2FO2 and a molecular weight of 285.09 g/mol. IUPAC name: 4-(3,4-dichlorophenyl)-2-fluorobenzoic acid. InChIKey: IUFAIVVWQHHJJL-UHFFFAOYSA-N.
| Molecular formula | C13H7Cl2FO2 |
|---|---|
| Molecular weight | 285.09 g/mol |
| IUPAC name | 4-(3,4-dichlorophenyl)-2-fluorobenzoic acid |
| InChIKey | IUFAIVVWQHHJJL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=C(C=C2)Cl)Cl)F)C(=O)O |
Computed by PubChem (NCBI)