Products 926241-32-9

CAS 926241-32-9 appears in our catalog under these names: 2,5-Dichloro-3-chlorosulfonyl-benzoic acid, 95%, 2,5-Dichloro-3-(chlorosulfonyl)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2,5-dichloro-3-chlorosulfonylbenzoic acid (CAS 926241-32-9) is a chemical compound with the molecular formula C7H3Cl3O4S and a molecular weight of 289.5 g/mol. IUPAC name: 2,5-dichloro-3-chlorosulfonylbenzoic acid. InChIKey: RXTNJWLBNOOVJQ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3Cl3O4S
Molecular weight289.5 g/mol
IUPAC name2,5-dichloro-3-chlorosulfonylbenzoic acid
InChIKeyRXTNJWLBNOOVJQ-UHFFFAOYSA-N
SMILESC1=C(C=C(C(=C1C(=O)O)Cl)S(=O)(=O)Cl)Cl

Computed by PubChem (NCBI)