Products 926243-85-8
CAS 926243-85-8 appears in our catalog under these names: 6-Hydrazinyl-N-(propan-2-yl)pyridine-3-sulfonamide, 95%, 6-Hydrazinyl-N-(propan-2-yl)pyridine-3-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
6-hydrazinyl-N-propan-2-ylpyridine-3-sulfonamide (CAS 926243-85-8) is a chemical compound with the molecular formula C8H14N4O2S and a molecular weight of 230.29 g/mol. IUPAC name: 6-hydrazinyl-N-propan-2-ylpyridine-3-sulfonamide. InChIKey: NVPVYARBMLFGRL-UHFFFAOYSA-N.
| Molecular formula | C8H14N4O2S |
|---|---|
| Molecular weight | 230.29 g/mol |
| IUPAC name | 6-hydrazinyl-N-propan-2-ylpyridine-3-sulfonamide |
| InChIKey | NVPVYARBMLFGRL-UHFFFAOYSA-N |
| SMILES | CC(C)NS(=O)(=O)C1=CN=C(C=C1)NN |
Computed by PubChem (NCBI)