CAS 926246-92-6 appears in our catalog under these names: 1-(3,4-Dichlorobenzoyl)piperidine-3-carboxylic acid, 95%, 1-(3,4-Dichlorobenzoyl)piperidine-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
1-(3,4-dichlorobenzoyl)piperidine-3-carboxylic acid (CAS 926246-92-6) is a chemical compound with the molecular formula C13H13Cl2NO3 and a molecular weight of 302.15 g/mol. IUPAC name: 1-(3,4-dichlorobenzoyl)piperidine-3-carboxylic acid. InChIKey: YRAOIOKKUQKJPZ-UHFFFAOYSA-N.
| Molecular formula | C13H13Cl2NO3 |
|---|---|
| Molecular weight | 302.15 g/mol |
| IUPAC name | 1-(3,4-dichlorobenzoyl)piperidine-3-carboxylic acid |
| InChIKey | YRAOIOKKUQKJPZ-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C(=O)C2=CC(=C(C=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)