Products 926256-15-7
CAS 926256-15-7 is the registry number for 1-(3-Chloro-4-methylphenyl)-6-oxo-1,6-dihydropyridazine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
1-(3-chloro-4-methylphenyl)-6-oxopyridazine-3-carboxylic acid (CAS 926256-15-7) is a chemical compound with the molecular formula C12H9ClN2O3 and a molecular weight of 264.66 g/mol. IUPAC name: 1-(3-chloro-4-methylphenyl)-6-oxopyridazine-3-carboxylic acid. InChIKey: YKLNHJGVODXAPG-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN2O3 |
|---|---|
| Molecular weight | 264.66 g/mol |
| IUPAC name | 1-(3-chloro-4-methylphenyl)-6-oxopyridazine-3-carboxylic acid |
| InChIKey | YKLNHJGVODXAPG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2C(=O)C=CC(=N2)C(=O)O)Cl |
Computed by PubChem (NCBI)