Products 926257-80-9
CAS 926257-80-9 appears in our catalog under these names: (2E)-3-[3,5-Dimethyl-1-(4-methylbenzyl)-1h-pyrazol-4-yl]acrylic acid, 95%, 3-{3,5-dimethyl-1-((4-methylphenyl)methyl)-1H-pyrazol-4-yl}prop-2-enoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
(E)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]prop-2-enoic acid (CAS 926257-80-9) is a chemical compound with the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. IUPAC name: (E)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]prop-2-enoic acid. InChIKey: DVVVFTHJVGFMQP-CMDGGOBGSA-N.
| Molecular formula | C16H18N2O2 |
|---|---|
| Molecular weight | 270.33 g/mol |
| IUPAC name | (E)-3-[3,5-dimethyl-1-[(4-methylphenyl)methyl]pyrazol-4-yl]prop-2-enoic acid |
| InChIKey | DVVVFTHJVGFMQP-CMDGGOBGSA-N |
| SMILES | CC1=CC=C(C=C1)CN2C(=C(C(=N2)C)/C=C/C(=O)O)C |
Computed by PubChem (NCBI)