CAS 926260-68-6 is the registry number for N-(2-Amino-4-chlorophenyl)-2-fluorobenzene-1-sulfonamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
N-(2-amino-4-chlorophenyl)-2-fluorobenzenesulfonamide (CAS 926260-68-6) is a chemical compound with the molecular formula C12H10ClFN2O2S and a molecular weight of 300.74 g/mol. IUPAC name: N-(2-amino-4-chlorophenyl)-2-fluorobenzenesulfonamide. InChIKey: RNOYUXYDFGJNHA-UHFFFAOYSA-N.
| Molecular formula | C12H10ClFN2O2S |
|---|---|
| Molecular weight | 300.74 g/mol |
| IUPAC name | N-(2-amino-4-chlorophenyl)-2-fluorobenzenesulfonamide |
| InChIKey | RNOYUXYDFGJNHA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)F)S(=O)(=O)NC2=C(C=C(C=C2)Cl)N |
Computed by PubChem (NCBI)