CAS 926261-73-6 is the registry number for 1-(2-Fluorophenyl)-1H,4H,5H,6H-cyclopenta(c)pyrazole-3-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-(2-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylic acid (CAS 926261-73-6) is a chemical compound with the molecular formula C13H11FN2O2 and a molecular weight of 246.24 g/mol. IUPAC name: 1-(2-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylic acid. InChIKey: FJPKVQQEPGUFCG-UHFFFAOYSA-N.
| Molecular formula | C13H11FN2O2 |
|---|---|
| Molecular weight | 246.24 g/mol |
| IUPAC name | 1-(2-fluorophenyl)-5,6-dihydro-4H-cyclopenta[d]pyrazole-3-carboxylic acid |
| InChIKey | FJPKVQQEPGUFCG-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)N(N=C2C(=O)O)C3=CC=CC=C3F |
Computed by PubChem (NCBI)