Products 926266-62-8
CAS 926266-62-8 is the registry number for 2-(4-tert-Butyl-2-methylphenoxy)propanoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-(4-tert-butyl-2-methylphenoxy)propanoic acid (CAS 926266-62-8) is a chemical compound with the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. IUPAC name: 2-(4-tert-butyl-2-methylphenoxy)propanoic acid. InChIKey: UNMADNBWSXWRIL-UHFFFAOYSA-N.
| Molecular formula | C14H20O3 |
|---|---|
| Molecular weight | 236.31 g/mol |
| IUPAC name | 2-(4-tert-butyl-2-methylphenoxy)propanoic acid |
| InChIKey | UNMADNBWSXWRIL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(C)(C)C)OC(C)C(=O)O |
Computed by PubChem (NCBI)