CAS 926268-91-9 is the registry number for 3-(Naphthalen-1-yl)-2,4-dioxo-1,2,3,4-tetrahydroquinazoline-7-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-naphthalen-1-yl-2,4-dioxo-1H-quinazoline-7-carboxylic acid (CAS 926268-91-9) is a chemical compound with the molecular formula C19H12N2O4 and a molecular weight of 332.3 g/mol. IUPAC name: 3-naphthalen-1-yl-2,4-dioxo-1H-quinazoline-7-carboxylic acid. InChIKey: VSXDUEQKPKJEOX-UHFFFAOYSA-N.
| Molecular formula | C19H12N2O4 |
|---|---|
| Molecular weight | 332.3 g/mol |
| IUPAC name | 3-naphthalen-1-yl-2,4-dioxo-1H-quinazoline-7-carboxylic acid |
| InChIKey | VSXDUEQKPKJEOX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2N3C(=O)C4=C(C=C(C=C4)C(=O)O)NC3=O |
Computed by PubChem (NCBI)