CAS 926276-10-0 appears in our catalog under these names: Cis-7-azabicyclo[3.3.0]octane, 95%, Cis-octahydro-cyclopenta[b]pyrrole hydrochloride, 95%, cis-Octahydrocyclopenta(c)pyrrole hydrochloride, 97%, cis-Octahydro-cyclopenta(C)pyrrole hydrochloride, rel-(3aR,6aS)-Octahydrocyclopenta[c]pyrrole hydrochloride, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 250mg, 25g, 2g, 100mg.
(3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole;hydrochloride (CAS 926276-10-0) is a chemical compound with the molecular formula C7H14ClN and a molecular weight of 147.64 g/mol. IUPAC name: (3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole;hydrochloride. InChIKey: HVZRRRPCVOJOLJ-UKMDXRBESA-N.
| Molecular formula | C7H14ClN |
|---|---|
| Molecular weight | 147.64 g/mol |
| IUPAC name | (3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole;hydrochloride |
| InChIKey | HVZRRRPCVOJOLJ-UKMDXRBESA-N |
| SMILES | C1C[C@@H]2CNC[C@@H]2C1.Cl |
Computed by PubChem (NCBI)