CAS 926276-11-1 appears in our catalog under these names: (1S,3aR,6aS)–Octahydrocyclopenta(c)pyrrole–1–carboxylic acid, (1S,3aR,6aS)-Octahydrocyclopenta[c]pyrrole-1-carboxylic acid, 97%, 97%, (1S,3aR,6aS)-Octahydrocyclopenta[c]pyrrole-1-carboxylic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 500mg.
(3S,3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxylic acid (CAS 926276-11-1) is a chemical compound with the molecular formula C8H13NO2 and a molecular weight of 155.19 g/mol. IUPAC name: (3S,3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxylic acid. InChIKey: KWRNCAUXSJOYQO-ACZMJKKPSA-N.
| Molecular formula | C8H13NO2 |
|---|---|
| Molecular weight | 155.19 g/mol |
| IUPAC name | (3S,3aS,6aR)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carboxylic acid |
| InChIKey | KWRNCAUXSJOYQO-ACZMJKKPSA-N |
| SMILES | C1C[C@H]2CN[C@@H]([C@H]2C1)C(=O)O |
Computed by PubChem (NCBI)