Products 926279-89-2
CAS 926279-89-2 is the registry number for 1-Pyrrolidinecarboxylic acid, 2-(hydroxymethyl)-4-methylene-, 1,1-dimethylethyl ester, (2R)-, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
Tert-butyl (2R)-2-(hydroxymethyl)-4-methylidenepyrrolidine-1-carboxylate (CAS 926279-89-2) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: tert-butyl (2R)-2-(hydroxymethyl)-4-methylidenepyrrolidine-1-carboxylate. InChIKey: LEQFXSMBUFJQLZ-SECBINFHSA-N.
| Molecular formula | C11H19NO3 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | tert-butyl (2R)-2-(hydroxymethyl)-4-methylidenepyrrolidine-1-carboxylate |
| InChIKey | LEQFXSMBUFJQLZ-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=C)C[C@@H]1CO |
Computed by PubChem (NCBI)