CAS 92665-29-7 appears in our catalog under these names: Cefprozil, 95%, Cefprozil (Mixture of Z and E Isomers), Cefprozil/ 98.1% (existing batch purity), Cefprozil, Cefprozil . Offered by: Combi-blocks, Chemat Brand, TargetMol, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 250mg, 100mg, on request, 1mg, 5mg, 10mg, 25mg.
(6R,7R)-7-[[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino]-8-oxo-3-prop-1-enyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS 92665-29-7) is a chemical compound with the molecular formula C18H19N3O5S and a molecular weight of 389.4 g/mol. IUPAC name: (6R,7R)-7-[[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino]-8-oxo-3-prop-1-enyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid. InChIKey: WDLWHQDACQUCJR-PBFPGSCMSA-N.
| Molecular formula | C18H19N3O5S |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | (6R,7R)-7-[[(2R)-2-amino-2-(4-hydroxyphenyl)acetyl]amino]-8-oxo-3-prop-1-enyl-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| InChIKey | WDLWHQDACQUCJR-PBFPGSCMSA-N |
| SMILES | CC=CC1=C(N2[C@@H]([C@@H](C2=O)NC(=O)[C@@H](C3=CC=C(C=C3)O)N)SC1)C(=O)O |
Computed by PubChem (NCBI)