Products 926905-78-4
CAS 926905-78-4 is the registry number for 1H-Imidazolium, 1-methyl-3-(3-sulfopropyl)-, 4-methylbenzenesulfonate(1:1), 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-methylbenzenesulfonate;3-(1-methyl-1,2-dihydroimidazol-1-ium-3-yl)propane-1-sulfonic acid (CAS 926905-78-4) is a chemical compound with the molecular formula C14H22N2O6S2 and a molecular weight of 378.5 g/mol. IUPAC name: 4-methylbenzenesulfonate;3-(1-methyl-1,2-dihydroimidazol-1-ium-3-yl)propane-1-sulfonic acid. InChIKey: KPJCNLGGJOQSOX-UHFFFAOYSA-N.
| Molecular formula | C14H22N2O6S2 |
|---|---|
| Molecular weight | 378.5 g/mol |
| IUPAC name | 4-methylbenzenesulfonate;3-(1-methyl-1,2-dihydroimidazol-1-ium-3-yl)propane-1-sulfonic acid |
| InChIKey | KPJCNLGGJOQSOX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)[O-].C[NH+]1CN(C=C1)CCCS(=O)(=O)O |
Computed by PubChem (NCBI)