CAS 78636-31-4 appears in our catalog under these names: Captopril Related Compound 10, Acetylcysteine Impurity 15, Captopril-N-acetylcysteine Disulfide. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2S)-1-[(2S)-3-[[(2R)-2-acetamido-2-carboxyethyl]disulfanyl]-2-methylpropanoyl]pyrrolidine-2-carboxylic acid (CAS 78636-31-4) is a chemical compound with the molecular formula C14H22N2O6S2 and a molecular weight of 378.5 g/mol. IUPAC name: (2S)-1-[(2S)-3-[[(2R)-2-acetamido-2-carboxyethyl]disulfanyl]-2-methylpropanoyl]pyrrolidine-2-carboxylic acid. InChIKey: GKTSZJWSDBILKT-MIMYLULJSA-N.
| Molecular formula | C14H22N2O6S2 |
|---|---|
| Molecular weight | 378.5 g/mol |
| IUPAC name | (2S)-1-[(2S)-3-[[(2R)-2-acetamido-2-carboxyethyl]disulfanyl]-2-methylpropanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | GKTSZJWSDBILKT-MIMYLULJSA-N |
| SMILES | C[C@H](CSSC[C@@H](C(=O)O)NC(=O)C)C(=O)N1CCC[C@H]1C(=O)O |
Computed by PubChem (NCBI)