Products 926922-29-4
CAS 926922-29-4 is the registry number for AP 24149. Offered by: MedChemExpress. Available pack sizes: Get quote.
9-[(E)-2-(2,6-dimethylphenyl)ethenyl]-N-(4-dimethylphosphorylphenyl)purin-6-amine (CAS 926922-29-4) is a chemical compound with the molecular formula C23H24N5OP and a molecular weight of 417.4 g/mol. IUPAC name: 9-[(E)-2-(2,6-dimethylphenyl)ethenyl]-N-(4-dimethylphosphorylphenyl)purin-6-amine. InChIKey: RFSFIDGEFVXSQM-OUKQBFOZSA-N.
| Molecular formula | C23H24N5OP |
|---|---|
| Molecular weight | 417.4 g/mol |
| IUPAC name | 9-[(E)-2-(2,6-dimethylphenyl)ethenyl]-N-(4-dimethylphosphorylphenyl)purin-6-amine |
| InChIKey | RFSFIDGEFVXSQM-OUKQBFOZSA-N |
| SMILES | CC1=C(C(=CC=C1)C)/C=C/N2C=NC3=C(N=CN=C32)NC4=CC=C(C=C4)P(=O)(C)C |
Computed by PubChem (NCBI)