CAS 927-20-8 appears in our catalog under these names: Magnesium Glycerophosphate, DL–ALPHA–GLYCEROL PHOSPHATE MAGNESIUM SALT HYDRATE, Glycerol-1-phosphate magnesium salt hydrate, Glycerol-1-phosphate magnesium salt hydrate, 95.00%, DL-ALPHA-GLYCEROL PHOSPHATE MAGNESIUM SA. Offered by: Chemat Brand, GLPBio, Biosynth, Chemat, Sigma-Aldrich. Available pack sizes: on request, 10g, 50g, 0,1kg, 0,25kg, 100g, 1kg, 250g.
Magnesium 2,3-dihydroxypropyl phosphate (CAS 927-20-8) is a chemical compound with the molecular formula C3H7MgO6P and a molecular weight of 194.36 g/mol. IUPAC name: magnesium 2,3-dihydroxypropyl phosphate. InChIKey: BHJKUVVFSKEBEX-UHFFFAOYSA-L.
| Molecular formula | C3H7MgO6P |
|---|---|
| Molecular weight | 194.36 g/mol |
| IUPAC name | magnesium 2,3-dihydroxypropyl phosphate |
| InChIKey | BHJKUVVFSKEBEX-UHFFFAOYSA-L |
| SMILES | C(C(COP(=O)([O-])[O-])O)O.[Mg+2] |
Computed by PubChem (NCBI)