Products 927182-31-8
CAS 927182-31-8 is the registry number for 3-Indoleacetonitrile-d4. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(4,5,6,7-tetradeuterio-1H-indol-3-yl)acetonitrile (CAS 927182-31-8) is a chemical compound with the molecular formula C10H8N2 and a molecular weight of 160.21 g/mol. IUPAC name: 2-(4,5,6,7-tetradeuterio-1H-indol-3-yl)acetonitrile. InChIKey: DMCPFOBLJMLSNX-RHQRLBAQSA-N.
| Molecular formula | C10H8N2 |
|---|---|
| Molecular weight | 160.21 g/mol |
| IUPAC name | 2-(4,5,6,7-tetradeuterio-1H-indol-3-yl)acetonitrile |
| InChIKey | DMCPFOBLJMLSNX-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=CN2)CC#N)[2H])[2H] |
Computed by PubChem (NCBI)