CAS 92726-05-1 appears in our catalog under these names: Tetracaine Impurity 12, Tetracaine Impurity 5, 4-(Dibutylamino)benzoic acid, 95%, Tetracaine Impurity 7. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-(dibutylamino)benzoic acid (CAS 92726-05-1) is a chemical compound with the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. IUPAC name: 4-(dibutylamino)benzoic acid. InChIKey: HSVJMWXLGNHXNV-UHFFFAOYSA-N.
| Molecular formula | C15H23NO2 |
|---|---|
| Molecular weight | 249.35 g/mol |
| IUPAC name | 4-(dibutylamino)benzoic acid |
| InChIKey | HSVJMWXLGNHXNV-UHFFFAOYSA-N |
| SMILES | CCCCN(CCCC)C1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)