Products 92751-20-7
CAS 92751-20-7 is the registry number for α-Ketoisocaproic acid-d7. Offered by: MedChemExpress. Available pack sizes: 1 mg.
4,5,5,5-tetradeuterio-2-oxo-4-(trideuteriomethyl)pentanoic acid (CAS 92751-20-7) is a chemical compound with the molecular formula C6H10O3 and a molecular weight of 137.18 g/mol. IUPAC name: 4,5,5,5-tetradeuterio-2-oxo-4-(trideuteriomethyl)pentanoic acid. InChIKey: BKAJNAXTPSGJCU-UAVYNJCWSA-N.
| Molecular formula | C6H10O3 |
|---|---|
| Molecular weight | 137.18 g/mol |
| IUPAC name | 4,5,5,5-tetradeuterio-2-oxo-4-(trideuteriomethyl)pentanoic acid |
| InChIKey | BKAJNAXTPSGJCU-UAVYNJCWSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(CC(=O)C(=O)O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)