CAS 92751-21-8 is the registry number for Teasterone . Offered by: Chemat Brand. Available pack sizes: on request.
Teasterone is a phytosteroid, a 3beta-hydroxy steroid, a 22-hydroxy steroid, a 23-hydroxy steroid and a 6-oxo steroid.
Source: ChEBI
| Molecular formula | C28H48O4 |
|---|---|
| Molecular weight | 448.7 g/mol |
| IUPAC name | (3S,5S,8S,9S,10R,13S,14S,17R)-17-[(2S,3R,4R,5S)-3,4-dihydroxy-5,6-dimethylheptan-2-yl]-3-hydroxy-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one |
| InChIKey | SBSXXCCMIWEPEE-GZKYLSGOSA-N |
| SMILES | C[C@@H]([C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC(=O)[C@@H]4[C@@]3(CC[C@@H](C4)O)C)C)[C@H]([C@@H]([C@@H](C)C(C)C)O)O |
Computed by PubChem (NCBI)