Products 927810-76-2

CAS 927810-76-2 is the registry number for Ethyl 4-Chlorobutyrate-d6. Offered by: TRC. Available pack sizes: 250mg, 25mg.

Structural formula: {0} (CAS {1})

Ethyl 4-chloro-2,2,3,3,4,4-hexadeuteriobutanoate (CAS 927810-76-2) is a chemical compound with the molecular formula C6H11ClO2 and a molecular weight of 156.64 g/mol. IUPAC name: ethyl 4-chloro-2,2,3,3,4,4-hexadeuteriobutanoate. InChIKey: OPXNFHAILOHHFO-RUJHVMJGSA-N.

Identity
Molecular formulaC6H11ClO2
Molecular weight156.64 g/mol
IUPAC nameethyl 4-chloro-2,2,3,3,4,4-hexadeuteriobutanoate
InChIKeyOPXNFHAILOHHFO-RUJHVMJGSA-N
SMILES[2H]C([2H])(C(=O)OCC)C([2H])([2H])C([2H])([2H])Cl

Computed by PubChem (NCBI)