Products 927838-01-5
CAS 927838-01-5 is the registry number for 1-tert-Butyl-6-chloro-1H,4H,5H-pyrazolo(3,4-d)pyrimidin-4-one. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
1-tert-butyl-6-chloro-5H-pyrazolo[5,4-d]pyrimidin-4-one (CAS 927838-01-5) is a chemical compound with the molecular formula C9H11ClN4O and a molecular weight of 226.66 g/mol. IUPAC name: 1-tert-butyl-6-chloro-5H-pyrazolo[5,4-d]pyrimidin-4-one. InChIKey: OOUXWYRIBKVRRI-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN4O |
|---|---|
| Molecular weight | 226.66 g/mol |
| IUPAC name | 1-tert-butyl-6-chloro-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| InChIKey | OOUXWYRIBKVRRI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C2=C(C=N1)C(=O)NC(=N2)Cl |
Computed by PubChem (NCBI)