CAS 92785-94-9 is the registry number for Magnesium taurinate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Magnesium bis(2-azanidylethanesulfonate) (CAS 92785-94-9) is a chemical compound with the molecular formula C4H10MgN2O6S2-2 and a molecular weight of 270.6 g/mol. IUPAC name: magnesium bis(2-azanidylethanesulfonate). InChIKey: UUZKKIIQTDKBQJ-UHFFFAOYSA-L.
| Molecular formula | C4H10MgN2O6S2-2 |
|---|---|
| Molecular weight | 270.6 g/mol |
| IUPAC name | magnesium bis(2-azanidylethanesulfonate) |
| InChIKey | UUZKKIIQTDKBQJ-UHFFFAOYSA-L |
| SMILES | C(CS(=O)(=O)[O-])[NH-].C(CS(=O)(=O)[O-])[NH-].[Mg+2] |
Computed by PubChem (NCBI)