CAS 927882-42-6 is the registry number for 2-(2-(2-oxo-2-((3,6,8-Trisulfonaphthalen-1-yl)amino)ethoxy)ethoxy)acetic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2-[2-oxo-2-[(3,6,8-trisulfonaphthalen-1-yl)amino]ethoxy]ethoxy]acetic acid (CAS 927882-42-6) is a chemical compound with the molecular formula C16H17NO14S3 and a molecular weight of 543.5 g/mol. IUPAC name: 2-[2-[2-oxo-2-[(3,6,8-trisulfonaphthalen-1-yl)amino]ethoxy]ethoxy]acetic acid. InChIKey: CXMBRJOTCKVGIV-UHFFFAOYSA-N.
| Molecular formula | C16H17NO14S3 |
|---|---|
| Molecular weight | 543.5 g/mol |
| IUPAC name | 2-[2-[2-oxo-2-[(3,6,8-trisulfonaphthalen-1-yl)amino]ethoxy]ethoxy]acetic acid |
| InChIKey | CXMBRJOTCKVGIV-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(C=C(C2=C(C=C1S(=O)(=O)O)NC(=O)COCCOCC(=O)O)S(=O)(=O)O)S(=O)(=O)O |
Computed by PubChem (NCBI)