CAS 928-04-1 appears in our catalog under these names: Potassium 3-carboxypropiolate, 98%, Acetylenedicarboxylic acid monopotassium salt,98%, Acetylenedicarboxylic Acid Monopotassium Salt, >95.0%(T), ACETYLENEDICARBOXYLIC ACID, MONOPOTASSI&. Offered by: Chemat Brand, GLPBio, TCI, Sigma-Aldrich. Available pack sizes: on request, 25g, 500g, 100G.
Potassium 4-hydroxy-4-oxobut-2-ynoate (CAS 928-04-1) is a chemical compound with the molecular formula C4HKO4 and a molecular weight of 152.15 g/mol. IUPAC name: potassium 4-hydroxy-4-oxobut-2-ynoate. InChIKey: KLLYWRUTRAFSJT-UHFFFAOYSA-M.
| Molecular formula | C4HKO4 |
|---|---|
| Molecular weight | 152.15 g/mol |
| IUPAC name | potassium 4-hydroxy-4-oxobut-2-ynoate |
| InChIKey | KLLYWRUTRAFSJT-UHFFFAOYSA-M |
| SMILES | C(#CC(=O)[O-])C(=O)O.[K+] |
Computed by PubChem (NCBI)