CAS 928-72-3 appears in our catalog under these names: Iminodiacetic Acid, Disodium Salt Monohydrate, Sodium 2,2'-azanediyldiacetate 98%, Sodium 2,2'-azanediyldiacetate, 98%, 98%, IMINODIACETIC ACID DISODIUM SALT, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 500g, 1000g, 25g, 1kg.
Disodium;2-(carboxylatomethylamino)acetate (CAS 928-72-3) is a chemical compound with the molecular formula C4H5NNa2O4 and a molecular weight of 177.07 g/mol. IUPAC name: disodium;2-(carboxylatomethylamino)acetate. InChIKey: HAXVIVNBOQIMTE-UHFFFAOYSA-L.
| Molecular formula | C4H5NNa2O4 |
|---|---|
| Molecular weight | 177.07 g/mol |
| IUPAC name | disodium;2-(carboxylatomethylamino)acetate |
| InChIKey | HAXVIVNBOQIMTE-UHFFFAOYSA-L |
| SMILES | C(C(=O)[O-])NCC(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)