Products 928-74-5

CAS 928-74-5 appears in our catalog under these names: 2–(2–Carbamothioylhydrazono)acetic acid, 2-(2-Carbamothioylhydrazono)acetic acid. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

(2E)-2-(carbamothioylhydrazinylidene)acetic acid (CAS 928-74-5) is a chemical compound with the molecular formula C3H5N3O2S and a molecular weight of 147.16 g/mol. IUPAC name: (2E)-2-(carbamothioylhydrazinylidene)acetic acid. InChIKey: LBPGMKDNBOKEEF-ORCRQEGFSA-N.

Identity
Molecular formulaC3H5N3O2S
Molecular weight147.16 g/mol
IUPAC name(2E)-2-(carbamothioylhydrazinylidene)acetic acid
InChIKeyLBPGMKDNBOKEEF-ORCRQEGFSA-N
SMILESC(=N/NC(=S)N)\C(=O)O

Computed by PubChem (NCBI)