CAS 92821-91-5 is the registry number for 2-Bromo-1-(3,5-dichlorophenyl)-1-propanone. Offered by: TRC. Available pack sizes: 500mg.
2-bromo-1-(3,5-dichlorophenyl)propan-1-one (CAS 92821-91-5) is a chemical compound with the molecular formula C9H7BrCl2O and a molecular weight of 281.96 g/mol. IUPAC name: 2-bromo-1-(3,5-dichlorophenyl)propan-1-one. InChIKey: GNIPVINPPLXVNW-UHFFFAOYSA-N.
| Molecular formula | C9H7BrCl2O |
|---|---|
| Molecular weight | 281.96 g/mol |
| IUPAC name | 2-bromo-1-(3,5-dichlorophenyl)propan-1-one |
| InChIKey | GNIPVINPPLXVNW-UHFFFAOYSA-N |
| SMILES | CC(C(=O)C1=CC(=CC(=C1)Cl)Cl)Br |
Computed by PubChem (NCBI)