CAS 928655-63-4 appears in our catalog under these names: HPN-01, 98%, HPN-01/ 98.07% (existing batch purity), HPN–01, Ikk inhibitor xii, HPN-01. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 2mg, 10mg, 25mg, 5mg, 50mg, 5 mg, 10mM/1mL.
2-amino-5-(4-chlorophenyl)-3-(4-sulfamoylphenyl)benzamide (CAS 928655-63-4) is a chemical compound with the molecular formula C19H16ClN3O3S and a molecular weight of 401.9 g/mol. IUPAC name: 2-amino-5-(4-chlorophenyl)-3-(4-sulfamoylphenyl)benzamide. InChIKey: XJLFMRGTLRIXDT-UHFFFAOYSA-N.
| Molecular formula | C19H16ClN3O3S |
|---|---|
| Molecular weight | 401.9 g/mol |
| IUPAC name | 2-amino-5-(4-chlorophenyl)-3-(4-sulfamoylphenyl)benzamide |
| InChIKey | XJLFMRGTLRIXDT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C(=CC(=C2)C3=CC=C(C=C3)Cl)C(=O)N)N)S(=O)(=O)N |
Computed by PubChem (NCBI)