CAS 928707-61-3 is the registry number for 2-Chloro-1-[4-(4-fluorophenyl)piperazin-1-yl]propan-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-chloro-1-[4-(4-fluorophenyl)piperazin-1-yl]propan-1-one (CAS 928707-61-3) is a chemical compound with the molecular formula C13H16ClFN2O and a molecular weight of 270.73 g/mol. IUPAC name: 2-chloro-1-[4-(4-fluorophenyl)piperazin-1-yl]propan-1-one. InChIKey: SQHVUCXOXGHTTH-UHFFFAOYSA-N.
| Molecular formula | C13H16ClFN2O |
|---|---|
| Molecular weight | 270.73 g/mol |
| IUPAC name | 2-chloro-1-[4-(4-fluorophenyl)piperazin-1-yl]propan-1-one |
| InChIKey | SQHVUCXOXGHTTH-UHFFFAOYSA-N |
| SMILES | CC(C(=O)N1CCN(CC1)C2=CC=C(C=C2)F)Cl |
Computed by PubChem (NCBI)