Products 928715-66-6
CAS 928715-66-6 is the registry number for alpha-Butyl-alpha-(2,4-dichlorophenyl)-4H-1,2,4-triazole-4-ethanol. Offered by: TRC. Available pack sizes: 500mg.
2-(2,4-dichlorophenyl)-1-(1,2,4-triazol-4-yl)hexan-2-ol (CAS 928715-66-6) is a chemical compound with the molecular formula C14H17Cl2N3O and a molecular weight of 314.2 g/mol. IUPAC name: 2-(2,4-dichlorophenyl)-1-(1,2,4-triazol-4-yl)hexan-2-ol. InChIKey: TVLXRXJTIDQREG-UHFFFAOYSA-N.
| Molecular formula | C14H17Cl2N3O |
|---|---|
| Molecular weight | 314.2 g/mol |
| IUPAC name | 2-(2,4-dichlorophenyl)-1-(1,2,4-triazol-4-yl)hexan-2-ol |
| InChIKey | TVLXRXJTIDQREG-UHFFFAOYSA-N |
| SMILES | CCCCC(CN1C=NN=C1)(C2=C(C=C(C=C2)Cl)Cl)O |
Computed by PubChem (NCBI)