CAS 929000-06-6 is the registry number for (N,N-Bis-t-Boc)-5-bromo-2-chloroaniline, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl N-(5-bromo-2-chlorophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (CAS 929000-06-6) is a chemical compound with the molecular formula C16H21BrClNO4 and a molecular weight of 406.7 g/mol. IUPAC name: tert-butyl N-(5-bromo-2-chlorophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate. InChIKey: YOBMEMQNHQDULV-UHFFFAOYSA-N.
| Molecular formula | C16H21BrClNO4 |
|---|---|
| Molecular weight | 406.7 g/mol |
| IUPAC name | tert-butyl N-(5-bromo-2-chlorophenyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| InChIKey | YOBMEMQNHQDULV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C1=C(C=CC(=C1)Br)Cl)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)