Products 929338-53-4
CAS 929338-53-4 appears in our catalog under these names: 3-[5-(4-Fluorophenyl)-1,2,4-oxadiazol-3-yl]aniline, 95%, 3-(5-(4-Fluorophenyl)-1,2,4-oxadiazol-3-yl)aniline, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
3-[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]aniline (CAS 929338-53-4) is a chemical compound with the molecular formula C14H10FN3O and a molecular weight of 255.25 g/mol. IUPAC name: 3-[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]aniline. InChIKey: LKRKUIXRGFLWSX-UHFFFAOYSA-N.
| Molecular formula | C14H10FN3O |
|---|---|
| Molecular weight | 255.25 g/mol |
| IUPAC name | 3-[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]aniline |
| InChIKey | LKRKUIXRGFLWSX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=NOC(=N2)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)