Products 929562-28-7
CAS 929562-28-7 is the registry number for JNJ-1930942. Offered by: MedChemExpress. Available pack sizes: Get quote.
[2-[4-fluoro-3-(trifluoromethyl)anilino]-4-pyridin-4-yl-1,3-thiazol-5-yl]methanol (CAS 929562-28-7) is a chemical compound with the molecular formula C16H11F4N3OS and a molecular weight of 369.3 g/mol. IUPAC name: [2-[4-fluoro-3-(trifluoromethyl)anilino]-4-pyridin-4-yl-1,3-thiazol-5-yl]methanol. InChIKey: JBSVHWCIKVSTTH-UHFFFAOYSA-N.
| Molecular formula | C16H11F4N3OS |
|---|---|
| Molecular weight | 369.3 g/mol |
| IUPAC name | [2-[4-fluoro-3-(trifluoromethyl)anilino]-4-pyridin-4-yl-1,3-thiazol-5-yl]methanol |
| InChIKey | JBSVHWCIKVSTTH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC2=NC(=C(S2)CO)C3=CC=NC=C3)C(F)(F)F)F |
Computed by PubChem (NCBI)