Products 929641-63-4
CAS 929641-63-4 is the registry number for LUF5981. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-cyclohexyl-5,7-diphenyl-1H-imidazo[4,5-b]pyridine (CAS 929641-63-4) is a chemical compound with the molecular formula C24H23N3 and a molecular weight of 353.5 g/mol. IUPAC name: 2-cyclohexyl-5,7-diphenyl-1H-imidazo[4,5-b]pyridine. InChIKey: DXBBMCIVYYJMJC-UHFFFAOYSA-N.
| Molecular formula | C24H23N3 |
|---|---|
| Molecular weight | 353.5 g/mol |
| IUPAC name | 2-cyclohexyl-5,7-diphenyl-1H-imidazo[4,5-b]pyridine |
| InChIKey | DXBBMCIVYYJMJC-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=NC3=C(N2)C(=CC(=N3)C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)