CAS 92973-24-5 appears in our catalog under these names: 5-(2-(Trifluoromethyl)phenyl)-2-furoic Acid, 5-[2-(Trifluoromethyl)phenyl]-2-furoic acid, 95%. Offered by: TRC, Combi-blocks. Available pack sizes: 10g, 5g, 1g.
5-[2-(trifluoromethyl)phenyl]furan-2-carboxylic acid (CAS 92973-24-5) is a chemical compound with the molecular formula C12H7F3O3 and a molecular weight of 256.18 g/mol. IUPAC name: 5-[2-(trifluoromethyl)phenyl]furan-2-carboxylic acid. InChIKey: IJPNRBZMRINMMR-UHFFFAOYSA-N.
| Molecular formula | C12H7F3O3 |
|---|---|
| Molecular weight | 256.18 g/mol |
| IUPAC name | 5-[2-(trifluoromethyl)phenyl]furan-2-carboxylic acid |
| InChIKey | IJPNRBZMRINMMR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(O2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)