CAS 929810-32-2 is the registry number for (2-([(4-Methoxyphenyl)sulfonyl]amino)-1,3-thiazol-4-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-[2-[(4-methoxyphenyl)sulfonylamino]-1,3-thiazol-4-yl]acetic acid (CAS 929810-32-2) is a chemical compound with the molecular formula C12H12N2O5S2 and a molecular weight of 328.4 g/mol. IUPAC name: 2-[2-[(4-methoxyphenyl)sulfonylamino]-1,3-thiazol-4-yl]acetic acid. InChIKey: ONNNPCGCFUVJDJ-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O5S2 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | 2-[2-[(4-methoxyphenyl)sulfonylamino]-1,3-thiazol-4-yl]acetic acid |
| InChIKey | ONNNPCGCFUVJDJ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)S(=O)(=O)NC2=NC(=CS2)CC(=O)O |
Computed by PubChem (NCBI)